C15H21NO5 — CID 98389767
trans-methyl (1R,3S,4Z)-3-butanoyl-2-oxo-4-prop-2-enoxyiminocyclohexane-1-carboxylate (PubChem CID 98389767) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is trans-methyl (1R,3S,4Z)-3-butanoyl-2-oxo-4-prop-2-enoxyiminocyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1R,3S,4Z)-3-butanoyl-2-oxo-4-prop-2-enoxyiminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 98389767 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | trans-methyl (1R,3S,4Z)-3-butanoyl-2-oxo-4-prop-2-enoxyiminocyclohexane-1-carboxylate |
| SMILES | C=CCO/N=C1/CC[C@@H](C(=O)OC)C(=O)[C@@H]1C(=O)CCC |
| InChI | InChI=1S/C15H21NO5/c1-4-6-12(17)13-11(16-21-9-5-2)8-7-10(14(13)18)15(19)20-3/h5,10,13H,2,4,6-9H2,1,3H3/b16-11-/t10-,13+/m1/s1 |
| InChIKey | AJEGLIMKSFLHED-GUUIMHJCSA-N |
| XLogP | 1.68 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|