C12H16Cl2O3 — CID 98389785
(2R)-2-butanoyl-4,4-dichloro-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 98389785) has the molecular formula C12H16Cl2O3 and a molecular weight of 279.16 g/mol. Its IUPAC name is (2R)-2-butanoyl-4,4-dichloro-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | (2R)-2-butanoyl-4,4-dichloro-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 98389785 |
| Molecular Formula | C12H16Cl2O3 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (2R)-2-butanoyl-4,4-dichloro-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCCC(=O)[C@@H]1C(=O)CC(C)(C)C(Cl)(Cl)C1=O |
| InChI | InChI=1S/C12H16Cl2O3/c1-4-5-7(15)9-8(16)6-11(2,3)12(13,14)10(9)17/h9H,4-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | KULYEVPPSRMWMX-SECBINFHSA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|