C19H14O2 — CID 98390961
(1R,12R)-12-methyl-19,20-dioxapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene (PubChem CID 98390961) has the molecular formula C19H14O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is (1R,12R)-12-methyl-19,20-dioxapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene.
| Compound Name | (1R,12R)-12-methyl-19,20-dioxapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene |
|---|---|
| PubChem CID | 98390961 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1R,12R)-12-methyl-19,20-dioxapentacyclo[10.6.2.02,11.03,8.013,18]icosa-2(11),3,5,7,9,13,15,17-octaene |
| SMILES | C[C@@]12OO[C@H](c3ccccc31)c1c2ccc2ccccc12 |
| InChI | InChI=1S/C19H14O2/c1-19-15-9-5-4-8-14(15)18(20-21-19)17-13-7-3-2-6-12(13)10-11-16(17)19/h2-11,18H,1H3/t18-,19-/m1/s1 |
| InChIKey | BKPSIVHKYKDHJO-RTBURBONSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|