C32H23F2N3O2S — CID 98391911
3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 98391911) has the molecular formula C32H23F2N3O2S and a molecular weight of 551.62 g/mol. Its IUPAC name is 3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 98391911 |
| Molecular Formula | C32H23F2N3O2S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 3-[2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(N2N=C3/C(=C/c4ccc(F)cc4)CCC[C@@H]3[C@@H]2c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C32H23F2N3O2S/c33-23-12-8-19(9-13-23)16-22-5-3-6-25-29(22)36-37(30(25)20-10-14-24(34)15-11-20)32-35-27(18-40-32)26-17-21-4-1-2-7-28(21)39-31(26)38/h1-2,4,7-18,25,30H,3,5-6H2/b22-16+/t25-,30-/m0/s1 |
| InChIKey | QCBIRBJZTLMNBO-WOWNTLNJSA-N |
| XLogP | 8.00 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|