C44H52N4 — CID 98393962
1-[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]-N-[4-[1-[4-[[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]methylideneamino]phenyl]cyclohexyl]phenyl]methanimine (PubChem CID 98393962) has the molecular formula C44H52N4 and a molecular weight of 636.93 g/mol. Its IUPAC name is 1-[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]-N-[4-[1-[4-[[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]methylideneamino]phenyl]cyclohexyl]phenyl]methanimine.
| Compound Name | 1-[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]-N-[4-[1-[4-[[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]methylideneamino]phenyl]cyclohexyl]phenyl]methanimine |
|---|---|
| PubChem CID | 98393962 |
| Molecular Formula | C44H52N4 |
| Molecular Weight | 636.93 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | 1-[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]-N-[4-[1-[4-[[(2R)-1,2,3,3-tetramethyl-2H-indol-5-yl]methylideneamino]phenyl]cyclohexyl]phenyl]methanimine |
| SMILES | C[C@H]1N(C)c2ccc(/C=N/c3ccc(C4(c5ccc(/N=C/c6ccc7c(c6)C(C)(C)[C@@H](C)N7C)cc5)CCCCC4)cc3)cc2C1(C)C |
| InChI | InChI=1S/C44H52N4/c1-30-42(3,4)38-26-32(12-22-40(38)47(30)7)28-45-36-18-14-34(15-19-36)44(24-10-9-11-25-44)35-16-20-37(21-17-35)46-29-33-13-23-41-39(27-33)43(5,6)31(2)48(41)8/h12-23,26-31H,9-11,24-25H2,1-8H3/b45-28+,46-29+/t30-,31-/m1/s1 |
| InChIKey | VOKLOUMOMZRSIM-BWVRTWODSA-N |
| XLogP | 10.67 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.93 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|