C22H24O2 — CID 98394115
(1R,2R,3S,4R,6S,7R)-4-[hydroxy(diphenyl)methyl]tricyclo[4.3.0.03,7]nonan-2-ol (PubChem CID 98394115) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1R,2R,3S,4R,6S,7R)-4-[hydroxy(diphenyl)methyl]tricyclo[4.3.0.03,7]nonan-2-ol.
| Compound Name | (1R,2R,3S,4R,6S,7R)-4-[hydroxy(diphenyl)methyl]tricyclo[4.3.0.03,7]nonan-2-ol |
|---|---|
| PubChem CID | 98394115 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1R,2R,3S,4R,6S,7R)-4-[hydroxy(diphenyl)methyl]tricyclo[4.3.0.03,7]nonan-2-ol |
| SMILES | O[C@@H]1[C@@H]2CC[C@@H]3[C@@H]2C[C@@H](C(O)(c2ccccc2)c2ccccc2)[C@@H]13 |
| InChI | InChI=1S/C22H24O2/c23-21-17-12-11-16-18(17)13-19(20(16)21)22(24,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-21,23-24H,11-13H2/t16-,17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | XWSHAONUVZUKOY-OXZADQLBSA-N |
| XLogP | 3.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |