C25H19BrN2O5 — CID 98394137
(3S)-N-(4-bromo-2,6-dimethylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide (PubChem CID 98394137) has the molecular formula C25H19BrN2O5 and a molecular weight of 507.34 g/mol. Its IUPAC name is (3S)-N-(4-bromo-2,6-dimethylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide.
| Compound Name | (3S)-N-(4-bromo-2,6-dimethylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 98394137 |
| Molecular Formula | C25H19BrN2O5 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | (3S)-N-(4-bromo-2,6-dimethylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-4-pyridin-4-ylbutanamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)C(=O)[C@H](C(=O)c1ccncc1)[C@H]1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H19BrN2O5/c1-13-11-16(26)12-14(2)20(13)28-24(31)22(30)19(21(29)15-7-9-27-10-8-15)23-17-5-3-4-6-18(17)25(32)33-23/h3-12,19,23H,1-2H3,(H,28,31)/t19-,23-/m0/s1 |
| InChIKey | KEKSCVKSYWXSLJ-CVDCTZTESA-N |
| XLogP | 4.38 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|