C20H20N2O5 — CID 98394290
ethyl 3-[[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]amino]benzoate (PubChem CID 98394290) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 3-[[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 98394290 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 3-[[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CN2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-2-27-20(26)13-4-3-5-14(9-13)21-15(23)10-22-18(24)16-11-6-7-12(8-11)17(16)19(22)25/h3-7,9,11-12,16-17H,2,8,10H2,1H3,(H,21,23)/t11-,12-,16+,17+/m0/s1 |
| InChIKey | BZCKFAMFKFJLMX-IYVPYFHTSA-N |
| XLogP | 1.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|