C28H21NO6 — CID 98394917
(E,3S)-N-(4-acetylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide (PubChem CID 98394917) has the molecular formula C28H21NO6 and a molecular weight of 467.48 g/mol. Its IUPAC name is (E,3S)-N-(4-acetylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide.
| Compound Name | (E,3S)-N-(4-acetylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 98394917 |
| Molecular Formula | C28H21NO6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (E,3S)-N-(4-acetylphenyl)-2,4-dioxo-3-[(1R)-3-oxo-1H-2-benzofuran-1-yl]-6-phenylhex-5-enamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)[C@H](C(=O)/C=C/c2ccccc2)[C@H]2OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H21NO6/c1-17(30)19-12-14-20(15-13-19)29-27(33)25(32)24(23(31)16-11-18-7-3-2-4-8-18)26-21-9-5-6-10-22(21)28(34)35-26/h2-16,24,26H,1H3,(H,29,33)/b16-11+/t24-,26-/m0/s1 |
| InChIKey | QCORVSOHHMRPAJ-GOZBKBCESA-N |
| XLogP | 4.21 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|