C20H27N3O4 — CID 98398259
2-[[(3R)-1-cyclopropyl-2,5-dioxopyrrolidin-3-yl]-(2-methoxyethyl)amino]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 98398259) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[[(3R)-1-cyclopropyl-2,5-dioxopyrrolidin-3-yl]-(2-methoxyethyl)amino]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[(3R)-1-cyclopropyl-2,5-dioxopyrrolidin-3-yl]-(2-methoxyethyl)amino]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 98398259 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[[(3R)-1-cyclopropyl-2,5-dioxopyrrolidin-3-yl]-(2-methoxyethyl)amino]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | COCCN(CC(=O)Nc1cccc(C)c1C)[C@@H]1CC(=O)N(C2CC2)C1=O |
| InChI | InChI=1S/C20H27N3O4/c1-13-5-4-6-16(14(13)2)21-18(24)12-22(9-10-27-3)17-11-19(25)23(20(17)26)15-7-8-15/h4-6,15,17H,7-12H2,1-3H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | ZPJUGOWDYFVCNG-QGZVFWFLSA-N |
| XLogP | 1.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|