C30H26ClN3O3 — CID 98398984
(1R,3R,3aR,6aR)-1-benzyl-5-(3-chlorophenyl)-1'-(2-methylprop-2-enyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 98398984) has the molecular formula C30H26ClN3O3 and a molecular weight of 512.01 g/mol. Its IUPAC name is (1R,3R,3aR,6aR)-1-benzyl-5-(3-chlorophenyl)-1'-(2-methylprop-2-enyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aR,6aR)-1-benzyl-5-(3-chlorophenyl)-1'-(2-methylprop-2-enyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 98398984 |
| Molecular Formula | C30H26ClN3O3 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (1R,3R,3aR,6aR)-1-benzyl-5-(3-chlorophenyl)-1'-(2-methylprop-2-enyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | C=C(C)CN1C(=O)[C@]2(N[C@H](Cc3ccccc3)[C@@H]3C(=O)N(c4cccc(Cl)c4)C(=O)[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C30H26ClN3O3/c1-18(2)17-33-24-14-7-6-13-22(24)30(29(33)37)26-25(23(32-30)15-19-9-4-3-5-10-19)27(35)34(28(26)36)21-12-8-11-20(31)16-21/h3-14,16,23,25-26,32H,1,15,17H2,2H3/t23-,25+,26+,30+/m1/s1 |
| InChIKey | HTPUQDFPACVWLH-QUOGVSKYSA-N |
| XLogP | 4.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|