C17H15BrN2O3 — CID 98400045
(1R,2S,6S,7S)-11-[(4-bromophenyl)methyl]-4-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione (PubChem CID 98400045) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is (1R,2S,6S,7S)-11-[(4-bromophenyl)methyl]-4-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione.
| Compound Name | (1R,2S,6S,7S)-11-[(4-bromophenyl)methyl]-4-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
|---|---|
| PubChem CID | 98400045 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (1R,2S,6S,7S)-11-[(4-bromophenyl)methyl]-4-methyl-4,11-diazatricyclo[5.3.1.02,6]undec-9-ene-3,5,8-trione |
| SMILES | CN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C(=O)C=C[C@H]2N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN2O3/c1-19-16(22)13-11-6-7-12(21)15(14(13)17(19)23)20(11)8-9-2-4-10(18)5-3-9/h2-7,11,13-15H,8H2,1H3/t11-,13-,14+,15-/m1/s1 |
| InChIKey | ANXAMWRRAOPZBM-REBRKWNGSA-N |
| XLogP | 1.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|