C27H19F2N3O2 — CID 98401570
(1R,2S,3S,3aR)-3-cyano-1-(4-fluorobenzoyl)-2-(4-fluorophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide (PubChem CID 98401570) has the molecular formula C27H19F2N3O2 and a molecular weight of 455.46 g/mol. Its IUPAC name is (1R,2S,3S,3aR)-3-cyano-1-(4-fluorobenzoyl)-2-(4-fluorophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide.
| Compound Name | (1R,2S,3S,3aR)-3-cyano-1-(4-fluorobenzoyl)-2-(4-fluorophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 98401570 |
| Molecular Formula | C27H19F2N3O2 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (1R,2S,3S,3aR)-3-cyano-1-(4-fluorobenzoyl)-2-(4-fluorophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3-carboxamide |
| SMILES | N#C[C@]1(C(N)=O)[C@H](c2ccc(F)cc2)[C@H](C(=O)c2ccc(F)cc2)N2c3ccccc3C=C[C@@H]21 |
| InChI | InChI=1S/C27H19F2N3O2/c28-19-10-5-17(6-11-19)23-24(25(33)18-7-12-20(29)13-8-18)32-21-4-2-1-3-16(21)9-14-22(32)27(23,15-30)26(31)34/h1-14,22-24H,(H2,31,34)/t22-,23-,24-,27-/m1/s1 |
| InChIKey | BZBVXZLIDJHKLY-ANNHOSHMSA-N |
| XLogP | 4.21 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |