C16H14N4OS — CID 98401711
(1'R,2S,5'R,6'S)-2'-amino-6'-benzylspiro[1,3-oxathiolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 98401711) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is (1'R,2S,5'R,6'S)-2'-amino-6'-benzylspiro[1,3-oxathiolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'R,2S,5'R,6'S)-2'-amino-6'-benzylspiro[1,3-oxathiolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 98401711 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (1'R,2S,5'R,6'S)-2'-amino-6'-benzylspiro[1,3-oxathiolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | N#C[C@@]12[C@@H](Cc3ccccc3)[C@@]1(C#N)C(N)=N[C@]21OCCS1 |
| InChI | InChI=1S/C16H14N4OS/c17-9-14-12(8-11-4-2-1-3-5-11)15(14,10-18)16(20-13(14)19)21-6-7-22-16/h1-5,12H,6-8H2,(H2,19,20)/t12-,14-,15+,16-/m0/s1 |
| InChIKey | YIISYQKFFXJCTR-HNKHHVNMSA-N |
| XLogP | 1.67 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |