C27H27ClN4O4S — CID 98404087
2-[(4R)-4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 98404087) has the molecular formula C27H27ClN4O4S and a molecular weight of 539.06 g/mol. Its IUPAC name is 2-[(4R)-4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-[(4R)-4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 98404087 |
| Molecular Formula | C27H27ClN4O4S |
| Molecular Weight | 539.06 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-[(4R)-4-(4-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(CN1CCc2sccc2[C@H]1c1ccc(Cl)cc1)N1CCCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C27H27ClN4O4S/c28-21-7-5-19(6-8-21)26-23-10-16-37-24(23)9-13-31(26)18-25(33)29-11-2-12-30(15-14-29)27(34)20-3-1-4-22(17-20)32(35)36/h1,3-8,10,16-17,26H,2,9,11-15,18H2/t26-/m1/s1 |
| InChIKey | VTZKYMJBFLTUDR-AREMUKBSSA-N |
| XLogP | 4.63 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.06 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|