C27H32ClF3N2O4 — CID 98408651
methyl 6-[4-[(2S)-2-(4-chlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazin-1-yl]-6-oxohexanoate (PubChem CID 98408651) has the molecular formula C27H32ClF3N2O4 and a molecular weight of 541.01 g/mol. Its IUPAC name is methyl 6-[4-[(2S)-2-(4-chlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazin-1-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[4-[(2S)-2-(4-chlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazin-1-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 98408651 |
| Molecular Formula | C27H32ClF3N2O4 |
| Molecular Weight | 541.01 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | methyl 6-[4-[(2S)-2-(4-chlorophenyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]ethyl]piperazin-1-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N1CCN(C[C@@H](OCc2ccc(C(F)(F)F)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H32ClF3N2O4/c1-36-26(35)5-3-2-4-25(34)33-16-14-32(15-17-33)18-24(21-8-12-23(28)13-9-21)37-19-20-6-10-22(11-7-20)27(29,30)31/h6-13,24H,2-5,14-19H2,1H3/t24-/m1/s1 |
| InChIKey | WJKMQVCMDUYNGD-XMMPIXPASA-N |
| XLogP | 5.49 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.01 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|