C27H32N2O7S — CID 98410833
[2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate (PubChem CID 98410833) has the molecular formula C27H32N2O7S and a molecular weight of 528.63 g/mol. Its IUPAC name is [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate.
| Compound Name | [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 98410833 |
| Molecular Formula | C27H32N2O7S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [2-oxo-2-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoate |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2C(=O)COC(=O)c2ccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)cc2)C1 |
| InChI | InChI=1S/C27H32N2O7S/c1-26(2)13-20-14-27(3,16-26)17-29(20)24(30)15-36-25(31)18-4-6-19(7-5-18)28-37(32,33)21-8-9-22-23(12-21)35-11-10-34-22/h4-9,12,20,28H,10-11,13-17H2,1-3H3/t20-,27+/m1/s1 |
| InChIKey | PURZOUACTQQBQK-HRFSGMKKSA-N |
| XLogP | 3.84 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |