C17H13N3O2S2 — CID 984115
N-(2-methyl-1,3-benzothiazol-5-yl)quinoline-8-sulfonamide (PubChem CID 984115) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-5-yl)quinoline-8-sulfonamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-5-yl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 984115 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-5-yl)quinoline-8-sulfonamide |
| SMILES | Cc1nc2cc(NS(=O)(=O)c3cccc4cccnc34)ccc2s1 |
| InChI | InChI=1S/C17H13N3O2S2/c1-11-19-14-10-13(7-8-15(14)23-11)20-24(21,22)16-6-2-4-12-5-3-9-18-17(12)16/h2-10,20H,1H3 |
| InChIKey | REBQDYNODILWQB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |