C16H20O — CID 98416423
(1S,10R,13R)-13-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4,6,8-triene (PubChem CID 98416423) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (1S,10R,13R)-13-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4,6,8-triene.
| Compound Name | (1S,10R,13R)-13-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4,6,8-triene |
|---|---|
| PubChem CID | 98416423 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1S,10R,13R)-13-methyl-14-oxatetracyclo[11.2.1.01,10.04,9]hexadeca-4,6,8-triene |
| SMILES | C[C@]12CC[C@@H]3c4ccccc4CC[C@]3(CO1)C2 |
| InChI | InChI=1S/C16H20O/c1-15-8-7-14-13-5-3-2-4-12(13)6-9-16(14,10-15)11-17-15/h2-5,14H,6-11H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | ADMBBYIIHVULRI-BZUAXINKSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |