C18H13Br2N3O6S — CID 98418174
[2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 98418174) has the molecular formula C18H13Br2N3O6S and a molecular weight of 559.19 g/mol. Its IUPAC name is [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 98418174 |
| Molecular Formula | C18H13Br2N3O6S |
| Molecular Weight | 559.19 g/mol |
| Exact Mass | 556.89 |
| IUPAC Name | [2-(2,6-dibromo-4-nitroanilino)-2-oxoethyl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | O=C(COC(=O)C[C@H]1Sc2ccccc2NC1=O)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H13Br2N3O6S/c19-10-5-9(23(27)28)6-11(20)17(10)22-15(24)8-29-16(25)7-14-18(26)21-12-3-1-2-4-13(12)30-14/h1-6,14H,7-8H2,(H,21,26)(H,22,24)/t14-/m1/s1 |
| InChIKey | GKISKCHQFRMRLV-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|