C14H8Cl3N3S — CID 984192
4-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 984192) has the molecular formula C14H8Cl3N3S and a molecular weight of 356.67 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 984192 |
| Molecular Formula | C14H8Cl3N3S |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 4-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8Cl3N3S/c15-8-1-4-10(5-2-8)20-13(18-19-14(20)21)11-6-3-9(16)7-12(11)17/h1-7H,(H,19,21) |
| InChIKey | ZLNXWIMQMQWAGJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|