C17H15IN2 — CID 98421337
(2S,5R,6S)-4-(4-iodophenyl)-2-methyl-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene (PubChem CID 98421337) has the molecular formula C17H15IN2 and a molecular weight of 374.23 g/mol. Its IUPAC name is (2S,5R,6S)-4-(4-iodophenyl)-2-methyl-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2S,5R,6S)-4-(4-iodophenyl)-2-methyl-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 98421337 |
| Molecular Formula | C17H15IN2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (2S,5R,6S)-4-(4-iodophenyl)-2-methyl-6-phenyl-1,3-diazabicyclo[3.1.0]hex-3-ene |
| SMILES | C[C@@H]1N=C(c2ccc(I)cc2)[C@H]2[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C17H15IN2/c1-11-19-15(12-7-9-14(18)10-8-12)17-16(20(11)17)13-5-3-2-4-6-13/h2-11,16-17H,1H3/t11-,16+,17+,20?/m1/s1 |
| InChIKey | CPXNFDWHWPLKFR-BOYGEHRKSA-N |
| XLogP | 3.87 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|