C18H21NO3 — CID 98421910
(3aR,4R,7R,7aS)-2-[(1S)-1-(4-methylphenyl)propyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98421910) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-2-[(1S)-1-(4-methylphenyl)propyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-2-[(1S)-1-(4-methylphenyl)propyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98421910 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (3aR,4R,7R,7aS)-2-[(1S)-1-(4-methylphenyl)propyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC[C@@H](c1ccc(C)cc1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C18H21NO3/c1-3-12(11-6-4-10(2)5-7-11)19-17(20)15-13-8-9-14(22-13)16(15)18(19)21/h4-7,12-16H,3,8-9H2,1-2H3/t12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | OGPMHIVGCUKUGV-CQJMVSDSSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|