C20H25NO5 — CID 98421926
(3aR,4R,7R,7aS)-2-[2-(3,4-diethoxyphenyl)ethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98421926) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-2-[2-(3,4-diethoxyphenyl)ethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-2-[2-(3,4-diethoxyphenyl)ethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98421926 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3aR,4R,7R,7aS)-2-[2-(3,4-diethoxyphenyl)ethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCOc1ccc(CCN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@H]3O2)cc1OCC |
| InChI | InChI=1S/C20H25NO5/c1-3-24-13-6-5-12(11-16(13)25-4-2)9-10-21-19(22)17-14-7-8-15(26-14)18(17)20(21)23/h5-6,11,14-15,17-18H,3-4,7-10H2,1-2H3/t14-,15-,17-,18+/m1/s1 |
| InChIKey | JFSDGUHUVNAULE-AHCXZYCDSA-N |
| XLogP | 2.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|