C22H15ClF4N2O4 — CID 98427507
(4R,5R,6S)-6-[5-(2-chlorophenyl)furan-2-yl]-4-(4-fluorophenyl)-4-hydroxy-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one (PubChem CID 98427507) has the molecular formula C22H15ClF4N2O4 and a molecular weight of 482.82 g/mol. Its IUPAC name is (4R,5R,6S)-6-[5-(2-chlorophenyl)furan-2-yl]-4-(4-fluorophenyl)-4-hydroxy-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6S)-6-[5-(2-chlorophenyl)furan-2-yl]-4-(4-fluorophenyl)-4-hydroxy-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 98427507 |
| Molecular Formula | C22H15ClF4N2O4 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (4R,5R,6S)-6-[5-(2-chlorophenyl)furan-2-yl]-4-(4-fluorophenyl)-4-hydroxy-5-(2,2,2-trifluoroacetyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@H](c2ccc(-c3ccccc3Cl)o2)[C@@H](C(=O)C(F)(F)F)[C@@](O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C22H15ClF4N2O4/c23-14-4-2-1-3-13(14)15-9-10-16(33-15)18-17(19(30)22(25,26)27)21(32,29-20(31)28-18)11-5-7-12(24)8-6-11/h1-10,17-18,32H,(H2,28,29,31)/t17-,18+,21-/m0/s1 |
| InChIKey | OCEUTKRJXFGSQD-UEXGIBASSA-N |
| XLogP | 4.69 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |