About N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide
N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide (PubChem CID 984297) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide |
| PubChem CID | 984297 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide |
| SMILES | COc1cc2cc(NC(C)=O)cc(NCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C21H22N2O3/c1-14(24)23-17-9-16-10-20(25-2)21(26-3)12-18(16)19(11-17)22-13-15-7-5-4-6-8-15/h4-12,22H,13H2,1-3H3,(H,23,24) |
| InChIKey | BLZNVYNNKSHQAL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide?
The IUPAC name of N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide (CID 984297) is N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide.
What is the SMILES notation for N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide?
The canonical SMILES for N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide is COc1cc2cc(NC(C)=O)cc(NCc3ccccc3)c2cc1OC.
What is the InChIKey of N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide?
The InChIKey is BLZNVYNNKSHQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-14(24)23-17-9-16-10-20(25-2)21(26-3)12-18(16)19(11-17)22-13-15-7-5-4-6-8-15/h4-12,22H,13H2,1-3H3,(H,23,24).
What are the key properties of N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide?
N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide has a molecular weight of 350.42 g/mol, XLogP of 4.43, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(benzylamino)-6,7-dimethoxynaphthalen-2-yl]acetamide is sourced from PubChem (CID 984297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).