C27H29ClN4O5S2 — CID 98438173
1-[(3R)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-2-[(4R)-4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone (PubChem CID 98438173) has the molecular formula C27H29ClN4O5S2 and a molecular weight of 589.14 g/mol. Its IUPAC name is 1-[(3R)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-2-[(4R)-4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(3R)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-2-[(4R)-4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 98438173 |
| Molecular Formula | C27H29ClN4O5S2 |
| Molecular Weight | 589.14 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 1-[(3R)-4-(4-chloro-3-nitrophenyl)sulfonyl-3-methylpiperazin-1-yl]-2-[(4R)-4-(4-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
| SMILES | Cc1ccc([C@@H]2c3ccsc3CCN2CC(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C27H29ClN4O5S2/c1-18-3-5-20(6-4-18)27-22-10-14-38-25(22)9-11-30(27)17-26(33)29-12-13-31(19(2)16-29)39(36,37)21-7-8-23(28)24(15-21)32(34)35/h3-8,10,14-15,19,27H,9,11-13,16-17H2,1-2H3/t19-,27-/m1/s1 |
| InChIKey | GTJMXBROCOSFQZ-XHCCPWGMSA-N |
| XLogP | 4.49 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.14 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|