C18H15N3O4 — CID 98443894
4-[(1R,2S,6R,7S,8S,12S)-10-ethyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile (PubChem CID 98443894) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-[(1R,2S,6R,7S,8S,12S)-10-ethyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile.
| Compound Name | 4-[(1R,2S,6R,7S,8S,12S)-10-ethyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile |
|---|---|
| PubChem CID | 98443894 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[(1R,2S,6R,7S,8S,12S)-10-ethyl-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-5-yl]benzonitrile |
| SMILES | CCN1C(=O)[C@@H]2[C@H]3O[C@@H]([C@H]4C(c5ccc(C#N)cc5)=NO[C@H]34)[C@H]2C1=O |
| InChI | InChI=1S/C18H15N3O4/c1-2-21-17(22)10-11(18(21)23)15-16-12(14(10)24-15)13(20-25-16)9-5-3-8(7-19)4-6-9/h3-6,10-12,14-16H,2H2,1H3/t10-,11-,12+,14+,15+,16-/m0/s1 |
| InChIKey | YRDYEXLCOMUXMQ-FBIFIEPWSA-N |
| XLogP | 0.68 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|