C23H26N2O3 — CID 98446854
(10S,11S,15S,16R)-16-acetyl-13-cyclohexyl-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 98446854) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (10S,11S,15S,16R)-16-acetyl-13-cyclohexyl-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11S,15S,16R)-16-acetyl-13-cyclohexyl-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 98446854 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (10S,11S,15S,16R)-16-acetyl-13-cyclohexyl-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CC(=O)[C@H]1[C@H]2C(=O)N(C3CCCCC3)C(=O)[C@@H]2[C@@H]2C=Cc3cc(C)ccc3N21 |
| InChI | InChI=1S/C23H26N2O3/c1-13-8-10-17-15(12-13)9-11-18-19-20(21(14(2)26)25(17)18)23(28)24(22(19)27)16-6-4-3-5-7-16/h8-12,16,18-21H,3-7H2,1-2H3/t18-,19+,20-,21-/m0/s1 |
| InChIKey | WIXZKTFRHYZACG-WOZUAGRISA-N |
| XLogP | 3.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|