C22H24N2O6S — CID 98449012
[4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 98449012) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is [4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 98449012 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [4-[[(1S)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | C[C@H](NC(=O)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C22H24N2O6S/c1-14(21-12-15-5-6-17(21)11-15)23-22(25)16-7-9-19(10-8-16)30-31(28,29)20-4-2-3-18(13-20)24(26)27/h2-4,7-10,13-15,17,21H,5-6,11-12H2,1H3,(H,23,25)/t14-,15-,17-,21-/m0/s1 |
| InChIKey | VOHZCDYWDYHEFK-WLNNIECUSA-N |
| XLogP | 3.92 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|