C14H15ClN2O3 — CID 98449789
(2R)-3-(4-chlorophenyl)-2-cyano-N-[(2S)-1-methoxypropan-2-yl]-3-oxopropanamide (PubChem CID 98449789) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (2R)-3-(4-chlorophenyl)-2-cyano-N-[(2S)-1-methoxypropan-2-yl]-3-oxopropanamide.
| Compound Name | (2R)-3-(4-chlorophenyl)-2-cyano-N-[(2S)-1-methoxypropan-2-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 98449789 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2R)-3-(4-chlorophenyl)-2-cyano-N-[(2S)-1-methoxypropan-2-yl]-3-oxopropanamide |
| SMILES | COC[C@H](C)NC(=O)[C@H](C#N)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-9(8-20-2)17-14(19)12(7-16)13(18)10-3-5-11(15)6-4-10/h3-6,9,12H,8H2,1-2H3,(H,17,19)/t9-,12+/m0/s1 |
| InChIKey | UNWNJMCNLVDBHQ-JOYOIKCWSA-N |
| XLogP | 1.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|