C31H20ClNO3S — CID 98451732
(1S,2S,3aS)-2-(2-chlorophenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 98451732) has the molecular formula C31H20ClNO3S and a molecular weight of 522.03 g/mol. Its IUPAC name is (1S,2S,3aS)-2-(2-chlorophenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2S,3aS)-2-(2-chlorophenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 98451732 |
| Molecular Formula | C31H20ClNO3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | (1S,2S,3aS)-2-(2-chlorophenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | O=C(c1cccs1)[C@@H]1[C@H](c2ccccc2Cl)C2(C(=O)c3ccccc3C2=O)[C@@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C31H20ClNO3S/c32-22-12-5-4-11-21(22)26-27(28(34)24-14-7-17-37-24)33-23-13-6-1-8-18(23)15-16-25(33)31(26)29(35)19-9-2-3-10-20(19)30(31)36/h1-17,25-27H/t25-,26-,27-/m0/s1 |
| InChIKey | KIAFULROTPOWJM-QKDODKLFSA-N |
| XLogP | 6.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|