About (4S)-4,6-dimethyl-4H-pyridazin-3-one
(4S)-4,6-dimethyl-4H-pyridazin-3-one (PubChem CID 98452253) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is (4S)-4,6-dimethyl-4H-pyridazin-3-one.
Molecular Properties
| Compound Name | (4S)-4,6-dimethyl-4H-pyridazin-3-one |
| PubChem CID | 98452253 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | (4S)-4,6-dimethyl-4H-pyridazin-3-one |
| SMILES | CC1=C[C@H](C)C(=O)N=N1 |
| InChI | InChI=1S/C6H8N2O/c1-4-3-5(2)7-8-6(4)9/h3-4H,1-2H3/t4-/m0/s1 |
| InChIKey | OPWYJGSEXQHVEP-BYPYZUCNSA-N |
| XLogP | 1.52 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4,6-dimethyl-4H-pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,6-dimethyl-4H-pyridazin-3-one?
The IUPAC name of (4S)-4,6-dimethyl-4H-pyridazin-3-one (CID 98452253) is (4S)-4,6-dimethyl-4H-pyridazin-3-one.
What is the SMILES notation for (4S)-4,6-dimethyl-4H-pyridazin-3-one?
The canonical SMILES for (4S)-4,6-dimethyl-4H-pyridazin-3-one is CC1=C[C@H](C)C(=O)N=N1.
What is the InChIKey of (4S)-4,6-dimethyl-4H-pyridazin-3-one?
The InChIKey is OPWYJGSEXQHVEP-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H8N2O/c1-4-3-5(2)7-8-6(4)9/h3-4H,1-2H3/t4-/m0/s1.
What are the key properties of (4S)-4,6-dimethyl-4H-pyridazin-3-one?
(4S)-4,6-dimethyl-4H-pyridazin-3-one has a molecular weight of 124.14 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,6-dimethyl-4H-pyridazin-3-one is sourced from PubChem (CID 98452253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).