C35H23FN2O4 — CID 98452631
(2'R,3S,3'S,10'bR)-2'-(1-benzofuran-2-carbonyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one (PubChem CID 98452631) has the molecular formula C35H23FN2O4 and a molecular weight of 554.58 g/mol. Its IUPAC name is (2'R,3S,3'S,10'bR)-2'-(1-benzofuran-2-carbonyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one.
| Compound Name | (2'R,3S,3'S,10'bR)-2'-(1-benzofuran-2-carbonyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
|---|---|
| PubChem CID | 98452631 |
| Molecular Formula | C35H23FN2O4 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | (2'R,3S,3'S,10'bR)-2'-(1-benzofuran-2-carbonyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,1'-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline]-2-one |
| SMILES | O=C(c1ccc(F)cc1)[C@@H]1[C@H](C(=O)c2cc3ccccc3o2)[C@@]2(C(=O)Nc3ccccc32)[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C35H23FN2O4/c36-23-15-13-21(14-16-23)31(39)30-29(32(40)28-19-22-8-2-6-12-27(22)42-28)35(25-10-4-5-11-26(25)37-34(35)41)33-24-9-3-1-7-20(24)17-18-38(30)33/h1-19,29-30,33H,(H,37,41)/t29-,30+,33-,35-/m1/s1 |
| InChIKey | QJCVHUUJICMMCU-ACZXLBTNSA-N |
| XLogP | 6.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |