C14H19F9 — CID 98453253
(E)-1,1,1,2,2,3,3,4,4-nonafluorotetradec-5-ene (PubChem CID 98453253) has the molecular formula C14H19F9 and a molecular weight of 358.29 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4-nonafluorotetradec-5-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4-nonafluorotetradec-5-ene |
|---|---|
| PubChem CID | 98453253 |
| Molecular Formula | C14H19F9 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4-nonafluorotetradec-5-ene |
| SMILES | CCCCCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F9/c1-2-3-4-5-6-7-8-9-10-11(15,16)12(17,18)13(19,20)14(21,22)23/h9-10H,2-8H2,1H3/b10-9+ |
| InChIKey | IYAUTGRZIRZZES-MDZDMXLPSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|