C13H14N2O10 — CID 98454072
dimethyl (1S,3R,5R,7S)-3,7-dinitro-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate (PubChem CID 98454072) has the molecular formula C13H14N2O10 and a molecular weight of 358.26 g/mol. Its IUPAC name is dimethyl (1S,3R,5R,7S)-3,7-dinitro-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate.
| Compound Name | dimethyl (1S,3R,5R,7S)-3,7-dinitro-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 98454072 |
| Molecular Formula | C13H14N2O10 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | dimethyl (1S,3R,5R,7S)-3,7-dinitro-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate |
| SMILES | COC(=O)[C@@]1([N+](=O)[O-])C[C@H]2C[C@@H](C[C@](C(=O)OC)([N+](=O)[O-])C2=O)C1=O |
| InChI | InChI=1S/C13H14N2O10/c1-24-10(18)12(14(20)21)4-6-3-7(8(12)16)5-13(9(6)17,15(22)23)11(19)25-2/h6-7H,3-5H2,1-2H3/t6-,7+,12-,13+ |
| InChIKey | GJDYHZYLVOZGIZ-NLPLKAIOSA-N |
| XLogP | -1.07 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|