C36H28N2O5 — CID 98454585
(1'S,2'R,3R,3'aS)-2'-(1,3-benzodioxole-5-carbonyl)-1'-benzoyl-5',7'-dimethylspiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 98454585) has the molecular formula C36H28N2O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aS)-2'-(1,3-benzodioxole-5-carbonyl)-1'-benzoyl-5',7'-dimethylspiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aS)-2'-(1,3-benzodioxole-5-carbonyl)-1'-benzoyl-5',7'-dimethylspiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 98454585 |
| Molecular Formula | C36H28N2O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | (1'S,2'R,3R,3'aS)-2'-(1,3-benzodioxole-5-carbonyl)-1'-benzoyl-5',7'-dimethylspiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=C[C@@H]2N(c3ccc(C)cc31)[C@H](C(=O)c1ccccc1)[C@H](C(=O)c1ccc3c(c1)OCO3)[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C36H28N2O5/c1-20-12-14-27-24(16-20)21(2)17-30-36(25-10-6-7-11-26(25)37-35(36)41)31(32(38(27)30)34(40)22-8-4-3-5-9-22)33(39)23-13-15-28-29(18-23)43-19-42-28/h3-18,30-32H,19H2,1-2H3,(H,37,41)/t30-,31+,32-,36+/m0/s1 |
| InChIKey | XCICHDJMQPMFRE-BSYZOHBLSA-N |
| XLogP | 5.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |