C34H23FN2O5 — CID 98455316
(1S,2R,3aR)-7-fluoro-1-(4-methylbenzoyl)-2-(4-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 98455316) has the molecular formula C34H23FN2O5 and a molecular weight of 558.57 g/mol. Its IUPAC name is (1S,2R,3aR)-7-fluoro-1-(4-methylbenzoyl)-2-(4-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2R,3aR)-7-fluoro-1-(4-methylbenzoyl)-2-(4-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 98455316 |
| Molecular Formula | C34H23FN2O5 |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (1S,2R,3aR)-7-fluoro-1-(4-methylbenzoyl)-2-(4-nitrophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | Cc1ccc(C(=O)[C@@H]2[C@H](c3ccc([N+](=O)[O-])cc3)C3(C(=O)c4ccccc4C3=O)[C@H]3C=Cc4cc(F)ccc4N23)cc1 |
| InChI | InChI=1S/C34H23FN2O5/c1-19-6-8-21(9-7-19)31(38)30-29(20-10-14-24(15-11-20)37(41)42)34(32(39)25-4-2-3-5-26(25)33(34)40)28-17-12-22-18-23(35)13-16-27(22)36(28)30/h2-18,28-30H,1H3/t28-,29+,30+/m1/s1 |
| InChIKey | UUPMHDPPIYRJFR-NGDRWEMDSA-N |
| XLogP | 6.36 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|