C18H23NO4 — CID 98455960
methyl (1R,2S,6R,7S)-4-cyclohexyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate (PubChem CID 98455960) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl (1R,2S,6R,7S)-4-cyclohexyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,6R,7S)-4-cyclohexyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate |
|---|---|
| PubChem CID | 98455960 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl (1R,2S,6R,7S)-4-cyclohexyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C=C[C@H](CC1)[C@H]1C(=O)N(C3CCCCC3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H23NO4/c1-23-17(22)18-9-7-11(8-10-18)13-14(18)16(21)19(15(13)20)12-5-3-2-4-6-12/h7,9,11-14H,2-6,8,10H2,1H3/t11-,13-,14-,18+/m1/s1 |
| InChIKey | DBGSMLLLQUEXBF-OPWYMKIUSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|