About (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one
(3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one (PubChem CID 98456298) has the molecular formula C10H10Br2N2O
and a molecular weight of 334.01 g/mol. Its IUPAC name is (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one |
| PubChem CID | 98456298 |
| Molecular Formula | C10H10Br2N2O |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one |
| SMILES | CN1C(=O)[C@@H](Br)C[C@]1(Br)c1cccnc1 |
| InChI | InChI=1S/C10H10Br2N2O/c1-14-9(15)8(11)5-10(14,12)7-3-2-4-13-6-7/h2-4,6,8H,5H2,1H3/t8-,10+/m0/s1 |
| InChIKey | DGLVUJAPHMRYOA-WCBMZHEXSA-N |
| XLogP | 2.25 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one?
The IUPAC name of (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one (CID 98456298) is (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one.
What is the SMILES notation for (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one?
The canonical SMILES for (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one is CN1C(=O)[C@@H](Br)C[C@]1(Br)c1cccnc1.
What is the InChIKey of (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one?
The InChIKey is DGLVUJAPHMRYOA-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H10Br2N2O/c1-14-9(15)8(11)5-10(14,12)7-3-2-4-13-6-7/h2-4,6,8H,5H2,1H3/t8-,10+/m0/s1.
What are the key properties of (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one?
(3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one has a molecular weight of 334.01 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3,5-dibromo-1-methyl-5-pyridin-3-ylpyrrolidin-2-one is sourced from PubChem (CID 98456298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).