C21H22N4O4S — CID 98456593
1-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-ethoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 98456593) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-ethoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-ethoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 98456593 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]ethyl]-3-(5-ethoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | CCOc1ccc2sc(NC(=O)NCCN3C(=O)[C@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)nc2c1 |
| InChI | InChI=1S/C21H22N4O4S/c1-2-29-13-5-6-15-14(10-13)23-21(30-15)24-20(28)22-7-8-25-18(26)16-11-3-4-12(9-11)17(16)19(25)27/h3-6,10-12,16-17H,2,7-9H2,1H3,(H2,22,23,24,28)/t11-,12-,16+,17+/m0/s1 |
| InChIKey | FCMHZZDHSQSHLR-IYVPYFHTSA-N |
| XLogP | 2.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|