C44H34N3+ — CID 98457249
4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-1,2,6-triphenylpyridin-1-ium (PubChem CID 98457249) has the molecular formula C44H34N3+ and a molecular weight of 604.78 g/mol. Its IUPAC name is 4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-1,2,6-triphenylpyridin-1-ium.
| Compound Name | 4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-1,2,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 98457249 |
| Molecular Formula | C44H34N3+ |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | 4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-1,2,6-triphenylpyridin-1-ium |
| SMILES | c1ccc(C2=NN(c3ccc(-c4cc(-c5ccccc5)[n+](-c5ccccc5)c(-c5ccccc5)c4)cc3)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C44H34N3/c1-6-16-34(17-7-1)41-32-44(37-22-12-4-13-23-37)47(45-41)40-28-26-33(27-29-40)38-30-42(35-18-8-2-9-19-35)46(39-24-14-5-15-25-39)43(31-38)36-20-10-3-11-21-36/h1-31,44H,32H2/q+1/t44-/m0/s1 |
| InChIKey | DMMMWNHDZBDUQI-SJARJILFSA-N |
| XLogP | 10.32 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|