About azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone
azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone (PubChem CID 98460118) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone.
Molecular Properties
| Compound Name | azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone |
| PubChem CID | 98460118 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone |
| SMILES | O=C(N1CCC1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C14H20ClNO/c15-14-7-10-4-11(8-14)6-13(5-10,9-14)12(17)16-2-1-3-16/h10-11H,1-9H2/t10-,11-,13?,14?/m1/s1 |
| InChIKey | YBMUVGGYZWCOET-IENTYSSBSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone?
The IUPAC name of azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone (CID 98460118) is azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone.
What is the SMILES notation for azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone?
The canonical SMILES for azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone is O=C(N1CCC1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2.
What is the InChIKey of azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone?
The InChIKey is YBMUVGGYZWCOET-IENTYSSBSA-N. The full InChI is InChI=1S/C14H20ClNO/c15-14-7-10-4-11(8-14)6-13(5-10,9-14)12(17)16-2-1-3-16/h10-11H,1-9H2/t10-,11-,13?,14?/m1/s1.
What are the key properties of azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone?
azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone has a molecular weight of 253.77 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-yl-[(5R,7R)-3-chloro-1-adamantyl]methanone is sourced from PubChem (CID 98460118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).