C23H20Cl2FN3O2S2 — CID 98460162
1-(2,3-dichlorophenyl)-3-[4-[[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]phenyl]thiourea (PubChem CID 98460162) has the molecular formula C23H20Cl2FN3O2S2 and a molecular weight of 524.47 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[4-[[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]phenyl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[4-[[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]phenyl]thiourea |
|---|---|
| PubChem CID | 98460162 |
| Molecular Formula | C23H20Cl2FN3O2S2 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[4-[[(2R)-6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]phenyl]thiourea |
| SMILES | C[C@@H]1CCc2cc(F)ccc2N1S(=O)(=O)c1ccc(NC(=S)Nc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C23H20Cl2FN3O2S2/c1-14-5-6-15-13-16(26)7-12-21(15)29(14)33(30,31)18-10-8-17(9-11-18)27-23(32)28-20-4-2-3-19(24)22(20)25/h2-4,7-14H,5-6H2,1H3,(H2,27,28,32)/t14-/m1/s1 |
| InChIKey | ZZSXIEOXTWLGDZ-CQSZACIVSA-N |
| XLogP | 6.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|