C9H5F6NO2 — CID 98460898
1-[2-amino-5-(trifluoromethoxy)phenyl]-2,2,2-trifluoroethanone (PubChem CID 98460898) has the molecular formula C9H5F6NO2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethoxy)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 98460898 |
| Molecular Formula | C9H5F6NO2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethoxy)phenyl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(OC(F)(F)F)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO2/c10-8(11,12)7(17)5-3-4(1-2-6(5)16)18-9(13,14)15/h1-3H,16H2 |
| InChIKey | QDTYJKHLFFVMHY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|