C24H24N2O2 — CID 984612
1-N,3-N-diethyl-1-N,3-N-diphenylbenzene-1,3-dicarboxamide (PubChem CID 984612) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-N,3-N-diethyl-1-N,3-N-diphenylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-diethyl-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 984612 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-N,3-N-diethyl-1-N,3-N-diphenylbenzene-1,3-dicarboxamide |
| SMILES | CCN(C(=O)c1cccc(C(=O)N(CC)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2/c1-3-25(21-14-7-5-8-15-21)23(27)19-12-11-13-20(18-19)24(28)26(4-2)22-16-9-6-10-17-22/h5-18H,3-4H2,1-2H3 |
| InChIKey | XAOUTZSLDUFREL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |