C24H36Cl3N3O2 — CID 98461418
3,4,4-trichloro-2-nitro-1-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1-N'-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]buta-1,3-diene-1,1-diamine (PubChem CID 98461418) has the molecular formula C24H36Cl3N3O2 and a molecular weight of 504.93 g/mol. Its IUPAC name is 3,4,4-trichloro-2-nitro-1-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1-N'-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]buta-1,3-diene-1,1-diamine.
| Compound Name | 3,4,4-trichloro-2-nitro-1-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1-N'-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]buta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 98461418 |
| Molecular Formula | C24H36Cl3N3O2 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 3,4,4-trichloro-2-nitro-1-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-1-N'-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]buta-1,3-diene-1,1-diamine |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](N/C(N[C@@H]1C[C@H]3CC[C@@]1(C)C3(C)C)=C(/C(Cl)=C(Cl)Cl)[N+](=O)[O-])C2 |
| InChI | InChI=1S/C24H36Cl3N3O2/c1-21(2)13-7-9-23(21,5)15(11-13)28-20(18(30(31)32)17(25)19(26)27)29-16-12-14-8-10-24(16,6)22(14,3)4/h13-16,28-29H,7-12H2,1-6H3/b20-18-/t13-,14+,15-,16-,23-,24+/m1/s1 |
| InChIKey | CUEJPZZHGWVTGL-NJPPHPPFSA-N |
| XLogP | 6.93 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|