C8H4BrF13O3S — CID 98463152
(4-bromo-3,3,4,4-tetrafluorobutyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 98463152) has the molecular formula C8H4BrF13O3S and a molecular weight of 507.06 g/mol. Its IUPAC name is (4-bromo-3,3,4,4-tetrafluorobutyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (4-bromo-3,3,4,4-tetrafluorobutyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 98463152 |
| Molecular Formula | C8H4BrF13O3S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 505.89 |
| IUPAC Name | (4-bromo-3,3,4,4-tetrafluorobutyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OCCC(F)(F)C(F)(F)Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4BrF13O3S/c9-6(16,17)3(10,11)1-2-25-26(23,24)8(21,22)5(14,15)4(12,13)7(18,19)20/h1-2H2 |
| InChIKey | MXSGSVQDUWZXOS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|