C9H17N — CID 98469517
[(1R,5R)-3-bicyclo[3.2.1]octanyl]methanamine (PubChem CID 98469517) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is [(1R,5R)-3-bicyclo[3.2.1]octanyl]methanamine.
| Compound Name | [(1R,5R)-3-bicyclo[3.2.1]octanyl]methanamine |
|---|---|
| PubChem CID | 98469517 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | [(1R,5R)-3-bicyclo[3.2.1]octanyl]methanamine |
| SMILES | NCC1C[C@@H]2CC[C@@H](C1)C2 |
| InChI | InChI=1S/C9H17N/c10-6-9-4-7-1-2-8(3-7)5-9/h7-9H,1-6,10H2/t7-,8-/m1/s1 |
| InChIKey | AOKVKPWLZTUIAE-HTQZYQBOSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |