About (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide
(E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 98470580) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide |
| PubChem CID | 98470580 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CN1[C@H]2CC[C@H]1CC(NC(=O)/C=C/c1cccc3ccccc13)C2 |
| InChI | InChI=1S/C21H24N2O/c1-23-18-10-11-19(23)14-17(13-18)22-21(24)12-9-16-7-4-6-15-5-2-3-8-20(15)16/h2-9,12,17-19H,10-11,13-14H2,1H3,(H,22,24)/b12-9+/t18-,19-/m0/s1 |
| InChIKey | ANEGKXXUNGIDBD-KSEZFFFOSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide?
The IUPAC name of (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide (CID 98470580) is (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide.
What is the SMILES notation for (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide?
The canonical SMILES for (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide is CN1[C@H]2CC[C@H]1CC(NC(=O)/C=C/c1cccc3ccccc13)C2.
What is the InChIKey of (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide?
The InChIKey is ANEGKXXUNGIDBD-KSEZFFFOSA-N. The full InChI is InChI=1S/C21H24N2O/c1-23-18-10-11-19(23)14-17(13-18)22-21(24)12-9-16-7-4-6-15-5-2-3-8-20(15)16/h2-9,12,17-19H,10-11,13-14H2,1H3,(H,22,24)/b12-9+/t18-,19-/m0/s1.
What are the key properties of (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide?
(E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide has a molecular weight of 320.44 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1S,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-3-naphthalen-1-ylprop-2-enamide is sourced from PubChem (CID 98470580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).